About [(7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol
[(7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol (PubChem CID 56961001) has the molecular formula C12H15Cl2NO2
and a molecular weight of 276.16 g/mol. Its IUPAC name is [(7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol.
Molecular Properties
| Compound Name | [(7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol |
| PubChem CID | 56961001 |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | [(7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol |
| SMILES | OC[C@@]1(c2ccc(Cl)c(Cl)c2)CCNCCO1 |
| InChI | InChI=1S/C12H15Cl2NO2/c13-10-2-1-9(7-11(10)14)12(8-16)3-4-15-5-6-17-12/h1-2,7,15-16H,3-6,8H2/t12-/m1/s1 |
| InChIKey | DFRNCACQYFTUEU-GFCCVEGCSA-N |
| XLogP | 2.19 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol?
The IUPAC name of [(7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol (CID 56961001) is [(7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol.
What is the SMILES notation for [(7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol?
The canonical SMILES for [(7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol is OC[C@@]1(c2ccc(Cl)c(Cl)c2)CCNCCO1.
What is the InChIKey of [(7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol?
The InChIKey is DFRNCACQYFTUEU-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H15Cl2NO2/c13-10-2-1-9(7-11(10)14)12(8-16)3-4-15-5-6-17-12/h1-2,7,15-16H,3-6,8H2/t12-/m1/s1.
What are the key properties of [(7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol?
[(7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol has a molecular weight of 276.16 g/mol, XLogP of 2.19, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol is sourced from PubChem (CID 56961001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).