C21H23F2N3O3 — CID 56961050
N-[2-(4-tert-butyl-3,5-difluorophenoxy)ethyl]-7-(hydroxymethyl)pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 56961050) has the molecular formula C21H23F2N3O3 and a molecular weight of 403.43 g/mol. Its IUPAC name is N-[2-(4-tert-butyl-3,5-difluorophenoxy)ethyl]-7-(hydroxymethyl)pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-[2-(4-tert-butyl-3,5-difluorophenoxy)ethyl]-7-(hydroxymethyl)pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56961050 |
| Molecular Formula | C21H23F2N3O3 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-[2-(4-tert-butyl-3,5-difluorophenoxy)ethyl]-7-(hydroxymethyl)pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | CC(C)(C)c1c(F)cc(OCCNC(=O)c2cnn3c(CO)cccc23)cc1F |
| InChI | InChI=1S/C21H23F2N3O3/c1-21(2,3)19-16(22)9-14(10-17(19)23)29-8-7-24-20(28)15-11-25-26-13(12-27)5-4-6-18(15)26/h4-6,9-11,27H,7-8,12H2,1-3H3,(H,24,28) |
| InChIKey | SNBOLRWYZPETPJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|