About 2-hydroxy-3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile
2-hydroxy-3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile (PubChem CID 56961407) has the molecular formula C23H17N3O2
and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-hydroxy-3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile.
Molecular Properties
| Compound Name | 2-hydroxy-3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile |
| PubChem CID | 56961407 |
| Molecular Formula | C23H17N3O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-hydroxy-3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile |
| SMILES | N#Cc1cccc(C2NC(=O)NC(c3ccccc3)=C2c2ccccc2)c1O |
| InChI | InChI=1S/C23H17N3O2/c24-14-17-12-7-13-18(22(17)27)21-19(15-8-3-1-4-9-15)20(25-23(28)26-21)16-10-5-2-6-11-16/h1-13,21,27H,(H2,25,26,28) |
| InChIKey | OYLHMNNILFDXGC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile?
The IUPAC name of 2-hydroxy-3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile (CID 56961407) is 2-hydroxy-3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile.
What is the SMILES notation for 2-hydroxy-3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile?
The canonical SMILES for 2-hydroxy-3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile is N#Cc1cccc(C2NC(=O)NC(c3ccccc3)=C2c2ccccc2)c1O.
What is the InChIKey of 2-hydroxy-3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile?
The InChIKey is OYLHMNNILFDXGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N3O2/c24-14-17-12-7-13-18(22(17)27)21-19(15-8-3-1-4-9-15)20(25-23(28)26-21)16-10-5-2-6-11-16/h1-13,21,27H,(H2,25,26,28).
What are the key properties of 2-hydroxy-3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile?
2-hydroxy-3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile has a molecular weight of 367.41 g/mol, XLogP of 4.19, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzonitrile is sourced from PubChem (CID 56961407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).