C35H30N6O7S — CID 56961507
5-[[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazine-1-carbothioyl]amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 56961507) has the molecular formula C35H30N6O7S and a molecular weight of 678.73 g/mol. Its IUPAC name is 5-[[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazine-1-carbothioyl]amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazine-1-carbothioyl]amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 56961507 |
| Molecular Formula | C35H30N6O7S |
| Molecular Weight | 678.73 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | 5-[[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazine-1-carbothioyl]amino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | COc1cc2nc(N3CCN(C(=S)Nc4ccc(-c5c6ccc(=O)cc-6oc6cc(O)ccc56)c(C(=O)O)c4)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C35H30N6O7S/c1-46-29-16-25-26(17-30(29)47-2)38-34(39-32(25)36)40-9-11-41(12-10-40)35(49)37-18-3-6-21(24(13-18)33(44)45)31-22-7-4-19(42)14-27(22)48-28-15-20(43)5-8-23(28)31/h3-8,13-17,42H,9-12H2,1-2H3,(H,37,49)(H,44,45)(H2,36,38,39) |
| InChIKey | MGYNRIYGDOFIPG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 176.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.73 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|