C19H18N6 — CID 56961805
2-cyclopropyl-6-N-(8-methylquinazolin-2-yl)-1H-benzimidazole-4,6-diamine (PubChem CID 56961805) has the molecular formula C19H18N6 and a molecular weight of 330.40 g/mol. Its IUPAC name is 2-cyclopropyl-6-N-(8-methylquinazolin-2-yl)-1H-benzimidazole-4,6-diamine.
| Compound Name | 2-cyclopropyl-6-N-(8-methylquinazolin-2-yl)-1H-benzimidazole-4,6-diamine |
|---|---|
| PubChem CID | 56961805 |
| Molecular Formula | C19H18N6 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-cyclopropyl-6-N-(8-methylquinazolin-2-yl)-1H-benzimidazole-4,6-diamine |
| SMILES | Cc1cccc2cnc(Nc3cc(N)c4nc(C5CC5)[nH]c4c3)nc12 |
| InChI | InChI=1S/C19H18N6/c1-10-3-2-4-12-9-21-19(25-16(10)12)22-13-7-14(20)17-15(8-13)23-18(24-17)11-5-6-11/h2-4,7-9,11H,5-6,20H2,1H3,(H,23,24)(H,21,22,25) |
| InChIKey | JTZQHCRTJWYSKG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|