C29H52F2O5Si — CID 56961902
propan-2-yl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopentyl]heptanoate (PubChem CID 56961902) has the molecular formula C29H52F2O5Si and a molecular weight of 546.81 g/mol. Its IUPAC name is propan-2-yl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopentyl]heptanoate.
| Compound Name | propan-2-yl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 56961902 |
| Molecular Formula | C29H52F2O5Si |
| Molecular Weight | 546.81 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | propan-2-yl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCC(F)(F)C(=O)CC[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@@H]1CCCCCCC(=O)OC(C)C |
| InChI | InChI=1S/C29H52F2O5Si/c1-9-10-19-29(30,31)26(33)18-17-23-22(15-13-11-12-14-16-27(34)35-21(2)3)24(32)20-25(23)36-37(7,8)28(4,5)6/h21-23,25H,9-20H2,1-8H3/t22-,23-,25-/m1/s1 |
| InChIKey | TUPLPALPMLMIJQ-VDKIKQQVSA-N |
| XLogP | 8.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.81 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|