C15H20O2 — CID 56962379
(3aS,3bS,6aS)-6a-hydroxy-3a,5,5-trimethyl-3-methylidene-3b,4,6,7-tetrahydrocyclopenta[a]pentalen-2-one (PubChem CID 56962379) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (3aS,3bS,6aS)-6a-hydroxy-3a,5,5-trimethyl-3-methylidene-3b,4,6,7-tetrahydrocyclopenta[a]pentalen-2-one.
| Compound Name | (3aS,3bS,6aS)-6a-hydroxy-3a,5,5-trimethyl-3-methylidene-3b,4,6,7-tetrahydrocyclopenta[a]pentalen-2-one |
|---|---|
| PubChem CID | 56962379 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (3aS,3bS,6aS)-6a-hydroxy-3a,5,5-trimethyl-3-methylidene-3b,4,6,7-tetrahydrocyclopenta[a]pentalen-2-one |
| SMILES | C=C1C(=O)C=C2C[C@@]3(O)CC(C)(C)C[C@H]3[C@]12C |
| InChI | InChI=1S/C15H20O2/c1-9-11(16)5-10-6-15(17)8-13(2,3)7-12(15)14(9,10)4/h5,12,17H,1,6-8H2,2-4H3/t12-,14+,15+/m0/s1 |
| InChIKey | CJYQFZYTBTVSGC-NWANDNLSSA-N |
| XLogP | 2.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|