C28H30N7O4P — CID 56962651
[2,2,3,3,5,5,6,6-octadeuterio-4-[[4-[[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]carbamoyl]phenyl]methyl]piperazin-1-yl]phosphonic acid (PubChem CID 56962651) has the molecular formula C28H30N7O4P and a molecular weight of 567.62 g/mol. Its IUPAC name is [2,2,3,3,5,5,6,6-octadeuterio-4-[[4-[[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]carbamoyl]phenyl]methyl]piperazin-1-yl]phosphonic acid.
| Compound Name | [2,2,3,3,5,5,6,6-octadeuterio-4-[[4-[[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]carbamoyl]phenyl]methyl]piperazin-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 56962651 |
| Molecular Formula | C28H30N7O4P |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | [2,2,3,3,5,5,6,6-octadeuterio-4-[[4-[[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]carbamoyl]phenyl]methyl]piperazin-1-yl]phosphonic acid |
| SMILES | [2H]C1([2H])N(Cc2ccc(C(=O)Nc3ccc(C)c(Nc4nccc(-c5cccnc5)n4)c3)cc2)C([2H])([2H])C([2H])([2H])N(P(=O)(O)O)C1([2H])[2H] |
| InChI | InChI=1S/C28H30N7O4P/c1-20-4-9-24(17-26(20)33-28-30-12-10-25(32-28)23-3-2-11-29-18-23)31-27(36)22-7-5-21(6-8-22)19-34-13-15-35(16-14-34)40(37,38)39/h2-12,17-18H,13-16,19H2,1H3,(H,31,36)(H,30,32,33)(H2,37,38,39)/i13D2,14D2,15D2,16D2 |
| InChIKey | KXYNGEUGYMDOTE-DBVREXLBSA-N |
| XLogP | 4.05 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|