C17H17N5O2S — CID 56962895
3-[[2-pyridin-2-yl-6-(thiophen-2-ylmethylamino)pyrimidin-4-yl]amino]propanoic acid (PubChem CID 56962895) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is 3-[[2-pyridin-2-yl-6-(thiophen-2-ylmethylamino)pyrimidin-4-yl]amino]propanoic acid.
| Compound Name | 3-[[2-pyridin-2-yl-6-(thiophen-2-ylmethylamino)pyrimidin-4-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 56962895 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 3-[[2-pyridin-2-yl-6-(thiophen-2-ylmethylamino)pyrimidin-4-yl]amino]propanoic acid |
| SMILES | O=C(O)CCNc1cc(NCc2cccs2)nc(-c2ccccn2)n1 |
| InChI | InChI=1S/C17H17N5O2S/c23-16(24)6-8-19-14-10-15(20-11-12-4-3-9-25-12)22-17(21-14)13-5-1-2-7-18-13/h1-5,7,9-10H,6,8,11H2,(H,23,24)(H2,19,20,21,22) |
| InChIKey | IXNWLWQZPZYBSG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |