C20H20N2O — CID 56963301
8,8-dimethyl-3-[2-(3-methylphenyl)ethynyl]-7,9-dihydro-6H-pyrido[3,2-c]azepin-5-one (PubChem CID 56963301) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is 8,8-dimethyl-3-[2-(3-methylphenyl)ethynyl]-7,9-dihydro-6H-pyrido[3,2-c]azepin-5-one.
| Compound Name | 8,8-dimethyl-3-[2-(3-methylphenyl)ethynyl]-7,9-dihydro-6H-pyrido[3,2-c]azepin-5-one |
|---|---|
| PubChem CID | 56963301 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 8,8-dimethyl-3-[2-(3-methylphenyl)ethynyl]-7,9-dihydro-6H-pyrido[3,2-c]azepin-5-one |
| SMILES | Cc1cccc(C#Cc2cnc3c(c2)C(=O)NCC(C)(C)C3)c1 |
| InChI | InChI=1S/C20H20N2O/c1-14-5-4-6-15(9-14)7-8-16-10-17-18(21-12-16)11-20(2,3)13-22-19(17)23/h4-6,9-10,12H,11,13H2,1-3H3,(H,22,23) |
| InChIKey | NKLJSZIVQOYHDO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|