C27H20N4O3 — CID 56963869
12-benzoyl-10-(furan-2-yl)-2,9,12,20-tetrazatetracyclo[9.9.0.03,8.014,19]icosa-1(20),3,5,7,14,16,18-heptaen-13-one (PubChem CID 56963869) has the molecular formula C27H20N4O3 and a molecular weight of 448.48 g/mol. Its IUPAC name is 12-benzoyl-10-(furan-2-yl)-2,9,12,20-tetrazatetracyclo[9.9.0.03,8.014,19]icosa-1(20),3,5,7,14,16,18-heptaen-13-one.
| Compound Name | 12-benzoyl-10-(furan-2-yl)-2,9,12,20-tetrazatetracyclo[9.9.0.03,8.014,19]icosa-1(20),3,5,7,14,16,18-heptaen-13-one |
|---|---|
| PubChem CID | 56963869 |
| Molecular Formula | C27H20N4O3 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 12-benzoyl-10-(furan-2-yl)-2,9,12,20-tetrazatetracyclo[9.9.0.03,8.014,19]icosa-1(20),3,5,7,14,16,18-heptaen-13-one |
| SMILES | O=C(c1ccccc1)N1C(=O)c2ccccc2N=C2Nc3ccccc3NC(c3ccco3)C21 |
| InChI | InChI=1S/C27H20N4O3/c32-26(17-9-2-1-3-10-17)31-24-23(22-15-8-16-34-22)28-20-13-6-7-14-21(20)30-25(24)29-19-12-5-4-11-18(19)27(31)33/h1-16,23-24,28H,(H,29,30) |
| InChIKey | DFSSVBZDDAIIAN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|