C16H24O3 — CID 56963935
(E,4R)-2-methyl-4-[(1R,3R,4S,5R)-1,4,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]pent-2-enal (PubChem CID 56963935) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (E,4R)-2-methyl-4-[(1R,3R,4S,5R)-1,4,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]pent-2-enal.
| Compound Name | (E,4R)-2-methyl-4-[(1R,3R,4S,5R)-1,4,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]pent-2-enal |
|---|---|
| PubChem CID | 56963935 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (E,4R)-2-methyl-4-[(1R,3R,4S,5R)-1,4,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]pent-2-enal |
| SMILES | CC1=CC[C@H]2O[C@]1(C)O[C@H]([C@H](C)/C=C(\C)C=O)[C@H]2C |
| InChI | InChI=1S/C16H24O3/c1-10(9-17)8-11(2)15-13(4)14-7-6-12(3)16(5,18-14)19-15/h6,8-9,11,13-15H,7H2,1-5H3/b10-8+/t11-,13+,14-,15-,16-/m1/s1 |
| InChIKey | ITRZFSMZAQWBOR-QXPQHQRHSA-N |
| XLogP | 3.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|