C15H9NO2 — CID 56963988
indolo[2,1-b][1,3]benzoxazin-12-one (PubChem CID 56963988) has the molecular formula C15H9NO2 and a molecular weight of 235.24 g/mol. Its IUPAC name is indolo[2,1-b][1,3]benzoxazin-12-one.
| Compound Name | indolo[2,1-b][1,3]benzoxazin-12-one |
|---|---|
| PubChem CID | 56963988 |
| Molecular Formula | C15H9NO2 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | indolo[2,1-b][1,3]benzoxazin-12-one |
| SMILES | O=c1c2ccccc2oc2cc3ccccc3n12 |
| InChI | InChI=1S/C15H9NO2/c17-15-11-6-2-4-8-13(11)18-14-9-10-5-1-3-7-12(10)16(14)15/h1-9H |
| InChIKey | CEKNGABJFDPACH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 34.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |