C43H79NO6SSi3 — CID 56964042
[(E,3S)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hex-1-en-5-yn-3-yl] (3S,6R,7S,8S)-4,4,6,8-tetramethyl-5-oxo-3,7,10-tris(triethylsilyloxy)decanoate (PubChem CID 56964042) has the molecular formula C43H79NO6SSi3 and a molecular weight of 822.43 g/mol. Its IUPAC name is [(E,3S)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hex-1-en-5-yn-3-yl] (3S,6R,7S,8S)-4,4,6,8-tetramethyl-5-oxo-3,7,10-tris(triethylsilyloxy)decanoate.
| Compound Name | [(E,3S)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hex-1-en-5-yn-3-yl] (3S,6R,7S,8S)-4,4,6,8-tetramethyl-5-oxo-3,7,10-tris(triethylsilyloxy)decanoate |
|---|---|
| PubChem CID | 56964042 |
| Molecular Formula | C43H79NO6SSi3 |
| Molecular Weight | 822.43 g/mol |
| Exact Mass | 821.49 |
| IUPAC Name | [(E,3S)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hex-1-en-5-yn-3-yl] (3S,6R,7S,8S)-4,4,6,8-tetramethyl-5-oxo-3,7,10-tris(triethylsilyloxy)decanoate |
| SMILES | C#CC[C@H](OC(=O)C[C@H](O[Si](CC)(CC)CC)C(C)(C)C(=O)[C@H](C)[C@@H](O[Si](CC)(CC)CC)[C@@H](C)CCO[Si](CC)(CC)CC)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C43H79NO6SSi3/c1-17-27-38(34(12)30-37-32-51-36(14)44-37)48-40(45)31-39(49-53(21-5,22-6)23-7)43(15,16)42(46)35(13)41(50-54(24-8,25-9)26-10)33(11)28-29-47-52(18-2,19-3)20-4/h1,30,32-33,35,38-39,41H,18-29,31H2,2-16H3/b34-30+/t33-,35+,38-,39-,41-/m0/s1 |
| InChIKey | HDSSALHCKAUJST-IYRPXCRPSA-N |
| XLogP | 12.24 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.43 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|