C20H19N3O3 — CID 56964195
3-[(E)-1-(furan-2-yl)-3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl]-2-methylquinazolin-4-one (PubChem CID 56964195) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 3-[(E)-1-(furan-2-yl)-3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl]-2-methylquinazolin-4-one.
| Compound Name | 3-[(E)-1-(furan-2-yl)-3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 56964195 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 3-[(E)-1-(furan-2-yl)-3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl]-2-methylquinazolin-4-one |
| SMILES | Cc1nc2ccccc2c(=O)n1/C(=C/c1ccco1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C20H19N3O3/c1-14-21-17-9-3-2-8-16(17)19(24)23(14)18(13-15-7-6-12-26-15)20(25)22-10-4-5-11-22/h2-3,6-9,12-13H,4-5,10-11H2,1H3/b18-13+ |
| InChIKey | KXBBJTXHXDQPPF-QGOAFFKASA-N |
| XLogP | 2.92 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|