C24H18N4O4S2 — CID 56964351
N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]-4-phenoxybenzenesulfonamide (PubChem CID 56964351) has the molecular formula C24H18N4O4S2 and a molecular weight of 490.57 g/mol. Its IUPAC name is N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]-4-phenoxybenzenesulfonamide.
| Compound Name | N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]-4-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 56964351 |
| Molecular Formula | C24H18N4O4S2 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | N-[4-hydroxy-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-yl]-4-phenoxybenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Sc2ncn[nH]2)c(O)c2ccccc12)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H18N4O4S2/c29-23-20-9-5-4-8-19(20)21(14-22(23)33-24-25-15-26-27-24)28-34(30,31)18-12-10-17(11-13-18)32-16-6-2-1-3-7-16/h1-15,28-29H,(H,25,26,27) |
| InChIKey | WLAVHZQEIYELPG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|