C23H28O3 — CID 56964572
(1S,9R,10R,15S)-4-ethoxy-9,14,15-trimethyl-17-methylidenetetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),4,13-triene-3,6-dione (PubChem CID 56964572) has the molecular formula C23H28O3 and a molecular weight of 352.47 g/mol. Its IUPAC name is (1S,9R,10R,15S)-4-ethoxy-9,14,15-trimethyl-17-methylidenetetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),4,13-triene-3,6-dione.
| Compound Name | (1S,9R,10R,15S)-4-ethoxy-9,14,15-trimethyl-17-methylidenetetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),4,13-triene-3,6-dione |
|---|---|
| PubChem CID | 56964572 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (1S,9R,10R,15S)-4-ethoxy-9,14,15-trimethyl-17-methylidenetetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),4,13-triene-3,6-dione |
| SMILES | C=C1[C@@H]2C[C@]3(C)C(C)=CCC[C@H]3[C@@]1(C)CC1=C2C(=O)C(OCC)=CC1=O |
| InChI | InChI=1S/C23H28O3/c1-6-26-18-10-17(24)16-12-23(5)14(3)15(20(16)21(18)25)11-22(4)13(2)8-7-9-19(22)23/h8,10,15,19H,3,6-7,9,11-12H2,1-2,4-5H3/t15-,19+,22+,23-/m0/s1 |
| InChIKey | GXNMLBUQQNMFRO-WUTZQBGQSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|