About 8-chloro-5-piperazin-1-ylpyrido[2,3-b][1,5]benzoxazepine
8-chloro-5-piperazin-1-ylpyrido[2,3-b][1,5]benzoxazepine (PubChem CID 56964693) has the molecular formula C16H15ClN4O
and a molecular weight of 314.78 g/mol. Its IUPAC name is 8-chloro-5-piperazin-1-ylpyrido[2,3-b][1,5]benzoxazepine.
Molecular Properties
| Compound Name | 8-chloro-5-piperazin-1-ylpyrido[2,3-b][1,5]benzoxazepine |
| PubChem CID | 56964693 |
| Molecular Formula | C16H15ClN4O |
| Molecular Weight | 314.78 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 8-chloro-5-piperazin-1-ylpyrido[2,3-b][1,5]benzoxazepine |
| SMILES | Clc1ccc2c(c1)N=C(N1CCNCC1)c1cccnc1O2 |
| InChI | InChI=1S/C16H15ClN4O/c17-11-3-4-14-13(10-11)20-15(21-8-6-18-7-9-21)12-2-1-5-19-16(12)22-14/h1-5,10,18H,6-9H2 |
| InChIKey | ZCSQZBVTVLZRJN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.78 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-chloro-5-piperazin-1-ylpyrido[2,3-b][1,5]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-5-piperazin-1-ylpyrido[2,3-b][1,5]benzoxazepine?
The IUPAC name of 8-chloro-5-piperazin-1-ylpyrido[2,3-b][1,5]benzoxazepine (CID 56964693) is 8-chloro-5-piperazin-1-ylpyrido[2,3-b][1,5]benzoxazepine.
What is the SMILES notation for 8-chloro-5-piperazin-1-ylpyrido[2,3-b][1,5]benzoxazepine?
The canonical SMILES for 8-chloro-5-piperazin-1-ylpyrido[2,3-b][1,5]benzoxazepine is Clc1ccc2c(c1)N=C(N1CCNCC1)c1cccnc1O2.
What is the InChIKey of 8-chloro-5-piperazin-1-ylpyrido[2,3-b][1,5]benzoxazepine?
The InChIKey is ZCSQZBVTVLZRJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClN4O/c17-11-3-4-14-13(10-11)20-15(21-8-6-18-7-9-21)12-2-1-5-19-16(12)22-14/h1-5,10,18H,6-9H2.
What are the key properties of 8-chloro-5-piperazin-1-ylpyrido[2,3-b][1,5]benzoxazepine?
8-chloro-5-piperazin-1-ylpyrido[2,3-b][1,5]benzoxazepine has a molecular weight of 314.78 g/mol, XLogP of 2.82, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-5-piperazin-1-ylpyrido[2,3-b][1,5]benzoxazepine is sourced from PubChem (CID 56964693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).