C22H18ClNO7 — CID 56965034
dimethyl (2R,5R)-2-(4-chlorophenyl)-5-(1,3-dioxoisoindol-2-yl)oxolane-3,3-dicarboxylate (PubChem CID 56965034) has the molecular formula C22H18ClNO7 and a molecular weight of 443.84 g/mol. Its IUPAC name is dimethyl (2R,5R)-2-(4-chlorophenyl)-5-(1,3-dioxoisoindol-2-yl)oxolane-3,3-dicarboxylate.
| Compound Name | dimethyl (2R,5R)-2-(4-chlorophenyl)-5-(1,3-dioxoisoindol-2-yl)oxolane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 56965034 |
| Molecular Formula | C22H18ClNO7 |
| Molecular Weight | 443.84 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | dimethyl (2R,5R)-2-(4-chlorophenyl)-5-(1,3-dioxoisoindol-2-yl)oxolane-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](N2C(=O)c3ccccc3C2=O)O[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18ClNO7/c1-29-20(27)22(21(28)30-2)11-16(31-17(22)12-7-9-13(23)10-8-12)24-18(25)14-5-3-4-6-15(14)19(24)26/h3-10,16-17H,11H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | FXSFUGDEEICTFM-IAGOWNOFSA-N |
| XLogP | 2.76 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.84 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|