C22H32O13S — CID 56965257
[(3S,4S,5R,6S)-4,5-diacetyloxy-6-[(3R,4S,5R,6S)-4,5-diacetyloxy-6-ethylsulfanyloxan-3-yl]oxyoxan-3-yl] acetate (PubChem CID 56965257) has the molecular formula C22H32O13S and a molecular weight of 536.55 g/mol. Its IUPAC name is [(3S,4S,5R,6S)-4,5-diacetyloxy-6-[(3R,4S,5R,6S)-4,5-diacetyloxy-6-ethylsulfanyloxan-3-yl]oxyoxan-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-[(3R,4S,5R,6S)-4,5-diacetyloxy-6-ethylsulfanyloxan-3-yl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 56965257 |
| Molecular Formula | C22H32O13S |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-[(3R,4S,5R,6S)-4,5-diacetyloxy-6-ethylsulfanyloxan-3-yl]oxyoxan-3-yl] acetate |
| SMILES | CCS[C@@H]1OC[C@@H](O[C@@H]2OC[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H32O13S/c1-7-36-22-20(34-14(6)27)18(32-12(4)25)16(9-29-22)35-21-19(33-13(5)26)17(31-11(3)24)15(8-28-21)30-10(2)23/h15-22H,7-9H2,1-6H3/t15-,16+,17-,18-,19+,20+,21-,22-/m0/s1 |
| InChIKey | FZCTYVFLYHHQPX-QJDFYSGISA-N |
| XLogP | 0.50 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|