C12H27N3 — CID 56965528
3-(1,4-diazepan-1-yl)-N,N-diethylpropan-1-amine (PubChem CID 56965528) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is 3-(1,4-diazepan-1-yl)-N,N-diethylpropan-1-amine.
| Compound Name | 3-(1,4-diazepan-1-yl)-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 56965528 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 3-(1,4-diazepan-1-yl)-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCN1CCCNCC1 |
| InChI | InChI=1S/C12H27N3/c1-3-14(4-2)10-6-11-15-9-5-7-13-8-12-15/h13H,3-12H2,1-2H3 |
| InChIKey | MBSRQZOEVHOQHO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |