About 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropan-1-amine;hydrochloride
1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropan-1-amine;hydrochloride (PubChem CID 56965656) has the molecular formula C6H10ClN3O
and a molecular weight of 175.62 g/mol. Its IUPAC name is 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropan-1-amine;hydrochloride |
| PubChem CID | 56965656 |
| Molecular Formula | C6H10ClN3O |
| Molecular Weight | 175.62 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropan-1-amine;hydrochloride |
| SMILES | Cc1noc(C2(N)CC2)n1.Cl |
| InChI | InChI=1S/C6H9N3O.ClH/c1-4-8-5(10-9-4)6(7)2-3-6;/h2-3,7H2,1H3;1H |
| InChIKey | UQUBCUKYYBBSIC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.62 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropan-1-amine;hydrochloride?
The IUPAC name of 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropan-1-amine;hydrochloride (CID 56965656) is 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropan-1-amine;hydrochloride.
What is the SMILES notation for 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropan-1-amine;hydrochloride?
The canonical SMILES for 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropan-1-amine;hydrochloride is Cc1noc(C2(N)CC2)n1.Cl.
What is the InChIKey of 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropan-1-amine;hydrochloride?
The InChIKey is UQUBCUKYYBBSIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O.ClH/c1-4-8-5(10-9-4)6(7)2-3-6;/h2-3,7H2,1H3;1H.
What are the key properties of 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropan-1-amine;hydrochloride?
1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropan-1-amine;hydrochloride has a molecular weight of 175.62 g/mol, XLogP of 0.75, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropan-1-amine;hydrochloride is sourced from PubChem (CID 56965656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).