About tert-butyl 4-hydrazinylpiperidine-1-carboxylate;hydrochloride
tert-butyl 4-hydrazinylpiperidine-1-carboxylate;hydrochloride (PubChem CID 56965815) has the molecular formula C10H22ClN3O2
and a molecular weight of 251.76 g/mol. Its IUPAC name is tert-butyl 4-hydrazinylpiperidine-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | tert-butyl 4-hydrazinylpiperidine-1-carboxylate;hydrochloride |
| PubChem CID | 56965815 |
| Molecular Formula | C10H22ClN3O2 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | tert-butyl 4-hydrazinylpiperidine-1-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CCC(NN)CC1.Cl |
| InChI | InChI=1S/C10H21N3O2.ClH/c1-10(2,3)15-9(14)13-6-4-8(12-11)5-7-13;/h8,12H,4-7,11H2,1-3H3;1H |
| InChIKey | VJURLDZABGSHRS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-hydrazinylpiperidine-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-hydrazinylpiperidine-1-carboxylate;hydrochloride?
The IUPAC name of tert-butyl 4-hydrazinylpiperidine-1-carboxylate;hydrochloride (CID 56965815) is tert-butyl 4-hydrazinylpiperidine-1-carboxylate;hydrochloride.
What is the SMILES notation for tert-butyl 4-hydrazinylpiperidine-1-carboxylate;hydrochloride?
The canonical SMILES for tert-butyl 4-hydrazinylpiperidine-1-carboxylate;hydrochloride is CC(C)(C)OC(=O)N1CCC(NN)CC1.Cl.
What is the InChIKey of tert-butyl 4-hydrazinylpiperidine-1-carboxylate;hydrochloride?
The InChIKey is VJURLDZABGSHRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O2.ClH/c1-10(2,3)15-9(14)13-6-4-8(12-11)5-7-13;/h8,12H,4-7,11H2,1-3H3;1H.
What are the key properties of tert-butyl 4-hydrazinylpiperidine-1-carboxylate;hydrochloride?
tert-butyl 4-hydrazinylpiperidine-1-carboxylate;hydrochloride has a molecular weight of 251.76 g/mol, XLogP of 1.27, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-hydrazinylpiperidine-1-carboxylate;hydrochloride is sourced from PubChem (CID 56965815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).