C30H24O2 — CID 56965911
(1R,16S)-27-(2-hydroxypropan-2-yl)heptacyclo[14.10.1.02,15.04,13.06,11.017,26.019,24]heptacosa-2,4,6,8,10,12,14,17,19,21,23,25-dodecaen-27-ol (PubChem CID 56965911) has the molecular formula C30H24O2 and a molecular weight of 416.52 g/mol. Its IUPAC name is (1R,16S)-27-(2-hydroxypropan-2-yl)heptacyclo[14.10.1.02,15.04,13.06,11.017,26.019,24]heptacosa-2,4,6,8,10,12,14,17,19,21,23,25-dodecaen-27-ol.
| Compound Name | (1R,16S)-27-(2-hydroxypropan-2-yl)heptacyclo[14.10.1.02,15.04,13.06,11.017,26.019,24]heptacosa-2,4,6,8,10,12,14,17,19,21,23,25-dodecaen-27-ol |
|---|---|
| PubChem CID | 56965911 |
| Molecular Formula | C30H24O2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (1R,16S)-27-(2-hydroxypropan-2-yl)heptacyclo[14.10.1.02,15.04,13.06,11.017,26.019,24]heptacosa-2,4,6,8,10,12,14,17,19,21,23,25-dodecaen-27-ol |
| SMILES | CC(C)(O)C1(O)[C@@H]2c3cc4ccccc4cc3[C@H]1c1cc3cc4ccccc4cc3cc12 |
| InChI | InChI=1S/C30H24O2/c1-29(2,31)30(32)27-23-13-19-9-5-6-10-20(19)14-24(23)28(30)26-16-22-12-18-8-4-3-7-17(18)11-21(22)15-25(26)27/h3-16,27-28,31-32H,1-2H3/t27-,28+,30? |
| InChIKey | OVGVCDMTTIACSZ-SCPSXFHPSA-N |
| XLogP | 6.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|