C20H24N6O2 — CID 56966228
3,11-bis[2-(dimethylamino)ethyl]-3,11,12,13-tetrazatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),5,7,9(16),10(14),12-hexaene-2,4-dione (PubChem CID 56966228) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 3,11-bis[2-(dimethylamino)ethyl]-3,11,12,13-tetrazatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),5,7,9(16),10(14),12-hexaene-2,4-dione.
| Compound Name | 3,11-bis[2-(dimethylamino)ethyl]-3,11,12,13-tetrazatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),5,7,9(16),10(14),12-hexaene-2,4-dione |
|---|---|
| PubChem CID | 56966228 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 3,11-bis[2-(dimethylamino)ethyl]-3,11,12,13-tetrazatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),5,7,9(16),10(14),12-hexaene-2,4-dione |
| SMILES | CN(C)CCN1C(=O)c2cccc3c2c(cc2nnn(CCN(C)C)c23)C1=O |
| InChI | InChI=1S/C20H24N6O2/c1-23(2)8-10-25-19(27)14-7-5-6-13-17(14)15(20(25)28)12-16-18(13)26(22-21-16)11-9-24(3)4/h5-7,12H,8-11H2,1-4H3 |
| InChIKey | OXMVKWSROJASQD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|