C12H23Cl2NO7S — CID 56966375
(2S,3S,4S,5R,6S)-2-[[3-(dichloroamino)-3-methylbutyl]sulfonylmethyl]-6-methoxyoxane-3,4,5-triol (PubChem CID 56966375) has the molecular formula C12H23Cl2NO7S and a molecular weight of 396.29 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-2-[[3-(dichloroamino)-3-methylbutyl]sulfonylmethyl]-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2S,3S,4S,5R,6S)-2-[[3-(dichloroamino)-3-methylbutyl]sulfonylmethyl]-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 56966375 |
| Molecular Formula | C12H23Cl2NO7S |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | (2S,3S,4S,5R,6S)-2-[[3-(dichloroamino)-3-methylbutyl]sulfonylmethyl]-6-methoxyoxane-3,4,5-triol |
| SMILES | CO[C@H]1O[C@H](CS(=O)(=O)CCC(C)(C)N(Cl)Cl)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H23Cl2NO7S/c1-12(2,15(13)14)4-5-23(19,20)6-7-8(16)9(17)10(18)11(21-3)22-7/h7-11,16-18H,4-6H2,1-3H3/t7-,8-,9+,10-,11+/m1/s1 |
| InChIKey | VVEBJJFCVTUFKQ-NZFPMDFQSA-N |
| XLogP | -0.37 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|