C23H24F2N6O6S — CID 56966480
1-(difluoromethyl)-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]pyrazole-4-sulfonamide (PubChem CID 56966480) has the molecular formula C23H24F2N6O6S and a molecular weight of 550.54 g/mol. Its IUPAC name is 1-(difluoromethyl)-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]pyrazole-4-sulfonamide.
| Compound Name | 1-(difluoromethyl)-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 56966480 |
| Molecular Formula | C23H24F2N6O6S |
| Molecular Weight | 550.54 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 1-(difluoromethyl)-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]pyrazole-4-sulfonamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2cnn(C(F)F)c2)c(OCCCO)c(OC)c1 |
| InChI | InChI=1S/C23H24F2N6O6S/c1-35-14-10-18(20(19(11-14)36-2)37-9-5-8-32)29-21-22(28-17-7-4-3-6-16(17)27-21)30-38(33,34)15-12-26-31(13-15)23(24)25/h3-4,6-7,10-13,23,32H,5,8-9H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | DYFRIQMNRTXPHN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 149.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|