C20H21F3N4O6S — CID 56966622
1,1,1-trifluoro-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]methanesulfonamide (PubChem CID 56966622) has the molecular formula C20H21F3N4O6S and a molecular weight of 502.47 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 56966622 |
| Molecular Formula | C20H21F3N4O6S |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 1,1,1-trifluoro-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]methanesulfonamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)C(F)(F)F)c(OCCCO)c(OC)c1 |
| InChI | InChI=1S/C20H21F3N4O6S/c1-31-12-10-15(17(16(11-12)32-2)33-9-5-8-28)26-18-19(27-34(29,30)20(21,22)23)25-14-7-4-3-6-13(14)24-18/h3-4,6-7,10-11,28H,5,8-9H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | XBWUVJOWGJCGRF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|