C28H26F2N6OS — CID 56966897
3-[[4-(4-cyanophenyl)pyrazol-1-yl]methyl]-N-[6-[2,2-difluoroethyl(methyl)amino]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]benzamide (PubChem CID 56966897) has the molecular formula C28H26F2N6OS and a molecular weight of 532.62 g/mol. Its IUPAC name is 3-[[4-(4-cyanophenyl)pyrazol-1-yl]methyl]-N-[6-[2,2-difluoroethyl(methyl)amino]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]benzamide.
| Compound Name | 3-[[4-(4-cyanophenyl)pyrazol-1-yl]methyl]-N-[6-[2,2-difluoroethyl(methyl)amino]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 56966897 |
| Molecular Formula | C28H26F2N6OS |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 3-[[4-(4-cyanophenyl)pyrazol-1-yl]methyl]-N-[6-[2,2-difluoroethyl(methyl)amino]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]benzamide |
| SMILES | CN(CC(F)F)C1CCc2nc(NC(=O)c3cccc(Cn4cc(-c5ccc(C#N)cc5)cn4)c3)sc2C1 |
| InChI | InChI=1S/C28H26F2N6OS/c1-35(17-26(29)30)23-9-10-24-25(12-23)38-28(33-24)34-27(37)21-4-2-3-19(11-21)15-36-16-22(14-32-36)20-7-5-18(13-31)6-8-20/h2-8,11,14,16,23,26H,9-10,12,15,17H2,1H3,(H,33,34,37) |
| InChIKey | NOCOEZJIXFIOMS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |