C24H23N3O3 — CID 56967047
methyl 5-cyclopropyl-2-[[2-(2-cyclopropyloxyphenyl)pyrimidin-5-yl]amino]benzoate (PubChem CID 56967047) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is methyl 5-cyclopropyl-2-[[2-(2-cyclopropyloxyphenyl)pyrimidin-5-yl]amino]benzoate.
| Compound Name | methyl 5-cyclopropyl-2-[[2-(2-cyclopropyloxyphenyl)pyrimidin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 56967047 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | methyl 5-cyclopropyl-2-[[2-(2-cyclopropyloxyphenyl)pyrimidin-5-yl]amino]benzoate |
| SMILES | COC(=O)c1cc(C2CC2)ccc1Nc1cnc(-c2ccccc2OC2CC2)nc1 |
| InChI | InChI=1S/C24H23N3O3/c1-29-24(28)20-12-16(15-6-7-15)8-11-21(20)27-17-13-25-23(26-14-17)19-4-2-3-5-22(19)30-18-9-10-18/h2-5,8,11-15,18,27H,6-7,9-10H2,1H3 |
| InChIKey | LOIMVRASLCAODN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |