About methyl 5-cyclopropyl-2-[[2-(2,5-difluorophenyl)pyrimidin-5-yl]amino]benzoate
methyl 5-cyclopropyl-2-[[2-(2,5-difluorophenyl)pyrimidin-5-yl]amino]benzoate (PubChem CID 56967048) has the molecular formula C21H17F2N3O2
and a molecular weight of 381.38 g/mol. Its IUPAC name is methyl 5-cyclopropyl-2-[[2-(2,5-difluorophenyl)pyrimidin-5-yl]amino]benzoate.
Molecular Properties
| Compound Name | methyl 5-cyclopropyl-2-[[2-(2,5-difluorophenyl)pyrimidin-5-yl]amino]benzoate |
| PubChem CID | 56967048 |
| Molecular Formula | C21H17F2N3O2 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | methyl 5-cyclopropyl-2-[[2-(2,5-difluorophenyl)pyrimidin-5-yl]amino]benzoate |
| SMILES | COC(=O)c1cc(C2CC2)ccc1Nc1cnc(-c2cc(F)ccc2F)nc1 |
| InChI | InChI=1S/C21H17F2N3O2/c1-28-21(27)17-8-13(12-2-3-12)4-7-19(17)26-15-10-24-20(25-11-15)16-9-14(22)5-6-18(16)23/h4-12,26H,2-3H2,1H3 |
| InChIKey | CAFJJKIWXGSLRA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-cyclopropyl-2-[[2-(2,5-difluorophenyl)pyrimidin-5-yl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-cyclopropyl-2-[[2-(2,5-difluorophenyl)pyrimidin-5-yl]amino]benzoate?
The IUPAC name of methyl 5-cyclopropyl-2-[[2-(2,5-difluorophenyl)pyrimidin-5-yl]amino]benzoate (CID 56967048) is methyl 5-cyclopropyl-2-[[2-(2,5-difluorophenyl)pyrimidin-5-yl]amino]benzoate.
What is the SMILES notation for methyl 5-cyclopropyl-2-[[2-(2,5-difluorophenyl)pyrimidin-5-yl]amino]benzoate?
The canonical SMILES for methyl 5-cyclopropyl-2-[[2-(2,5-difluorophenyl)pyrimidin-5-yl]amino]benzoate is COC(=O)c1cc(C2CC2)ccc1Nc1cnc(-c2cc(F)ccc2F)nc1.
What is the InChIKey of methyl 5-cyclopropyl-2-[[2-(2,5-difluorophenyl)pyrimidin-5-yl]amino]benzoate?
The InChIKey is CAFJJKIWXGSLRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17F2N3O2/c1-28-21(27)17-8-13(12-2-3-12)4-7-19(17)26-15-10-24-20(25-11-15)16-9-14(22)5-6-18(16)23/h4-12,26H,2-3H2,1H3.
What are the key properties of methyl 5-cyclopropyl-2-[[2-(2,5-difluorophenyl)pyrimidin-5-yl]amino]benzoate?
methyl 5-cyclopropyl-2-[[2-(2,5-difluorophenyl)pyrimidin-5-yl]amino]benzoate has a molecular weight of 381.38 g/mol, XLogP of 4.83, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-cyclopropyl-2-[[2-(2,5-difluorophenyl)pyrimidin-5-yl]amino]benzoate is sourced from PubChem (CID 56967048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).