C25H24F2N4O6S — CID 56967053
3,4-difluoro-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]benzenesulfonamide (PubChem CID 56967053) has the molecular formula C25H24F2N4O6S and a molecular weight of 546.55 g/mol. Its IUPAC name is 3,4-difluoro-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 56967053 |
| Molecular Formula | C25H24F2N4O6S |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | 3,4-difluoro-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]benzenesulfonamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(F)c(F)c2)c(OCCCO)c(OC)c1 |
| InChI | InChI=1S/C25H24F2N4O6S/c1-35-15-12-21(23(22(13-15)36-2)37-11-5-10-32)30-24-25(29-20-7-4-3-6-19(20)28-24)31-38(33,34)16-8-9-17(26)18(27)14-16/h3-4,6-9,12-14,32H,5,10-11H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | MRUDUAVKNUEVEK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|