C26H26F2N4O7S — CID 56967054
3,4-difluoro-N-[3-[2-[2-(2-hydroxyethoxy)ethoxy]-3,5-dimethoxyanilino]quinoxalin-2-yl]benzenesulfonamide (PubChem CID 56967054) has the molecular formula C26H26F2N4O7S and a molecular weight of 576.58 g/mol. Its IUPAC name is 3,4-difluoro-N-[3-[2-[2-(2-hydroxyethoxy)ethoxy]-3,5-dimethoxyanilino]quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-[3-[2-[2-(2-hydroxyethoxy)ethoxy]-3,5-dimethoxyanilino]quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 56967054 |
| Molecular Formula | C26H26F2N4O7S |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | 3,4-difluoro-N-[3-[2-[2-(2-hydroxyethoxy)ethoxy]-3,5-dimethoxyanilino]quinoxalin-2-yl]benzenesulfonamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(F)c(F)c2)c(OCCOCCO)c(OC)c1 |
| InChI | InChI=1S/C26H26F2N4O7S/c1-36-16-13-22(24(23(14-16)37-2)39-12-11-38-10-9-33)31-25-26(30-21-6-4-3-5-20(21)29-25)32-40(34,35)17-7-8-18(27)19(28)15-17/h3-8,13-15,33H,9-12H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | GHOAYALDOUPCHS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 141.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|