C22H24N4O2 — CID 56967198
benzyl 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate (PubChem CID 56967198) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is benzyl 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate.
| Compound Name | benzyl 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 56967198 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | benzyl 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCC2C1CCN2c1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C22H24N4O2/c27-22(28-15-16-5-2-1-3-6-16)26-13-4-7-19-20(26)10-14-25(19)18-9-12-24-21-17(18)8-11-23-21/h1-3,5-6,8-9,11-12,19-20H,4,7,10,13-15H2,(H,23,24) |
| InChIKey | SAEXXCWQWXLWCZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |