C28H28F3N5O7S — CID 56967230
4-[[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 56967230) has the molecular formula C28H28F3N5O7S and a molecular weight of 635.62 g/mol. Its IUPAC name is 4-[[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 56967230 |
| Molecular Formula | C28H28F3N5O7S |
| Molecular Weight | 635.62 g/mol |
| Exact Mass | 635.17 |
| IUPAC Name | 4-[[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(C(=O)NCC(F)(F)F)cc2)c(OCCCO)c(OC)c1 |
| InChI | InChI=1S/C28H28F3N5O7S/c1-41-18-14-22(24(23(15-18)42-2)43-13-5-12-37)35-25-26(34-21-7-4-3-6-20(21)33-25)36-44(39,40)19-10-8-17(9-11-19)27(38)32-16-28(29,30)31/h3-4,6-11,14-15,37H,5,12-13,16H2,1-2H3,(H,32,38)(H,33,35)(H,34,36) |
| InChIKey | OCMZAMPPVPGMBH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 161.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|