C19H16IN3O — CID 56967318
7-iodo-21-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15,17,19-heptaen-14-one (PubChem CID 56967318) has the molecular formula C19H16IN3O and a molecular weight of 429.26 g/mol. Its IUPAC name is 7-iodo-21-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15,17,19-heptaen-14-one.
| Compound Name | 7-iodo-21-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15,17,19-heptaen-14-one |
|---|---|
| PubChem CID | 56967318 |
| Molecular Formula | C19H16IN3O |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 7-iodo-21-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15,17,19-heptaen-14-one |
| SMILES | CN1c2ccccc2C(=O)N2CCc3c([nH]c4ccc(I)cc34)C21 |
| InChI | InChI=1S/C19H16IN3O/c1-22-16-5-3-2-4-13(16)19(24)23-9-8-12-14-10-11(20)6-7-15(14)21-17(12)18(22)23/h2-7,10,18,21H,8-9H2,1H3 |
| InChIKey | XDYOPSPVHBQTNY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|