About 7-ethoxy-2,2-dimethyl-1'-(pyridin-3-ylmethyl)spiro[3H-chromene-4,3'-indole]-2'-one
7-ethoxy-2,2-dimethyl-1'-(pyridin-3-ylmethyl)spiro[3H-chromene-4,3'-indole]-2'-one (PubChem CID 56967592) has the molecular formula C26H26N2O3
and a molecular weight of 414.51 g/mol. Its IUPAC name is 7-ethoxy-2,2-dimethyl-1'-(pyridin-3-ylmethyl)spiro[3H-chromene-4,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 7-ethoxy-2,2-dimethyl-1'-(pyridin-3-ylmethyl)spiro[3H-chromene-4,3'-indole]-2'-one |
| PubChem CID | 56967592 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 7-ethoxy-2,2-dimethyl-1'-(pyridin-3-ylmethyl)spiro[3H-chromene-4,3'-indole]-2'-one |
| SMILES | CCOc1ccc2c(c1)OC(C)(C)CC21C(=O)N(Cc2cccnc2)c2ccccc21 |
| InChI | InChI=1S/C26H26N2O3/c1-4-30-19-11-12-21-23(14-19)31-25(2,3)17-26(21)20-9-5-6-10-22(20)28(24(26)29)16-18-8-7-13-27-15-18/h5-15H,4,16-17H2,1-3H3 |
| InChIKey | BASTVGGZMNPILS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-ethoxy-2,2-dimethyl-1'-(pyridin-3-ylmethyl)spiro[3H-chromene-4,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-2,2-dimethyl-1'-(pyridin-3-ylmethyl)spiro[3H-chromene-4,3'-indole]-2'-one?
The IUPAC name of 7-ethoxy-2,2-dimethyl-1'-(pyridin-3-ylmethyl)spiro[3H-chromene-4,3'-indole]-2'-one (CID 56967592) is 7-ethoxy-2,2-dimethyl-1'-(pyridin-3-ylmethyl)spiro[3H-chromene-4,3'-indole]-2'-one.
What is the SMILES notation for 7-ethoxy-2,2-dimethyl-1'-(pyridin-3-ylmethyl)spiro[3H-chromene-4,3'-indole]-2'-one?
The canonical SMILES for 7-ethoxy-2,2-dimethyl-1'-(pyridin-3-ylmethyl)spiro[3H-chromene-4,3'-indole]-2'-one is CCOc1ccc2c(c1)OC(C)(C)CC21C(=O)N(Cc2cccnc2)c2ccccc21.
What is the InChIKey of 7-ethoxy-2,2-dimethyl-1'-(pyridin-3-ylmethyl)spiro[3H-chromene-4,3'-indole]-2'-one?
The InChIKey is BASTVGGZMNPILS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N2O3/c1-4-30-19-11-12-21-23(14-19)31-25(2,3)17-26(21)20-9-5-6-10-22(20)28(24(26)29)16-18-8-7-13-27-15-18/h5-15H,4,16-17H2,1-3H3.
What are the key properties of 7-ethoxy-2,2-dimethyl-1'-(pyridin-3-ylmethyl)spiro[3H-chromene-4,3'-indole]-2'-one?
7-ethoxy-2,2-dimethyl-1'-(pyridin-3-ylmethyl)spiro[3H-chromene-4,3'-indole]-2'-one has a molecular weight of 414.51 g/mol, XLogP of 4.87, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-2,2-dimethyl-1'-(pyridin-3-ylmethyl)spiro[3H-chromene-4,3'-indole]-2'-one is sourced from PubChem (CID 56967592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).