C21H23N5O2 — CID 56967632
benzyl 1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate (PubChem CID 56967632) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is benzyl 1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate.
| Compound Name | benzyl 1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 56967632 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | benzyl 1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCC2C1CCN2c1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C21H23N5O2/c27-21(28-13-15-5-2-1-3-6-15)26-11-4-7-17-18(26)9-12-25(17)20-16-8-10-22-19(16)23-14-24-20/h1-3,5-6,8,10,14,17-18H,4,7,9,11-13H2,(H,22,23,24) |
| InChIKey | SZHLRQPLYAYSOT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |