C20H22N6O2 — CID 56967634
pyridin-3-ylmethyl 1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate (PubChem CID 56967634) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is pyridin-3-ylmethyl 1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate.
| Compound Name | pyridin-3-ylmethyl 1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 56967634 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | pyridin-3-ylmethyl 1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate |
| SMILES | O=C(OCc1cccnc1)N1CCCC2C1CCN2c1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C20H22N6O2/c27-20(28-12-14-3-1-7-21-11-14)26-9-2-4-16-17(26)6-10-25(16)19-15-5-8-22-18(15)23-13-24-19/h1,3,5,7-8,11,13,16-17H,2,4,6,9-10,12H2,(H,22,23,24) |
| InChIKey | QFFPTGLUHBTHSM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |