C19H18N4O — CID 56968045
17-amino-21-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15(20),16,18-heptaen-14-one (PubChem CID 56968045) has the molecular formula C19H18N4O and a molecular weight of 318.38 g/mol. Its IUPAC name is 17-amino-21-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15(20),16,18-heptaen-14-one.
| Compound Name | 17-amino-21-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15(20),16,18-heptaen-14-one |
|---|---|
| PubChem CID | 56968045 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 17-amino-21-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15(20),16,18-heptaen-14-one |
| SMILES | CN1c2ccc(N)cc2C(=O)N2CCc3c([nH]c4ccccc34)C21 |
| InChI | InChI=1S/C19H18N4O/c1-22-16-7-6-11(20)10-14(16)19(24)23-9-8-13-12-4-2-3-5-15(12)21-17(13)18(22)23/h2-7,10,18,21H,8-9,20H2,1H3 |
| InChIKey | LIXTYEKQWKIPSL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|