C21H31NO5S — CID 56968133
(S)-N-[(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-enyl]-2-methylpropane-2-sulfinamide (PubChem CID 56968133) has the molecular formula C21H31NO5S and a molecular weight of 409.55 g/mol. Its IUPAC name is (S)-N-[(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-enyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-enyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 56968133 |
| Molecular Formula | C21H31NO5S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (S)-N-[(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-enyl]-2-methylpropane-2-sulfinamide |
| SMILES | C=C[C@@H](N[S@@](=O)C(C)(C)C)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H31NO5S/c1-7-15(22-28(23)20(2,3)4)16-17(24-13-14-11-9-8-10-12-14)18-19(25-16)27-21(5,6)26-18/h7-12,15-19,22H,1,13H2,2-6H3/t15-,16-,17+,18-,19-,28+/m1/s1 |
| InChIKey | RMAXWYZISCUTMR-GRIRAFEESA-N |
| XLogP | 3.05 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|