C40H50O2Si2 — CID 56968344
tert-butyl-[(3E,5E)-8-[tert-butyl(diphenyl)silyl]oxyocta-3,5-dienoxy]-diphenylsilane (PubChem CID 56968344) has the molecular formula C40H50O2Si2 and a molecular weight of 619.01 g/mol. Its IUPAC name is tert-butyl-[(3E,5E)-8-[tert-butyl(diphenyl)silyl]oxyocta-3,5-dienoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(3E,5E)-8-[tert-butyl(diphenyl)silyl]oxyocta-3,5-dienoxy]-diphenylsilane |
|---|---|
| PubChem CID | 56968344 |
| Molecular Formula | C40H50O2Si2 |
| Molecular Weight | 619.01 g/mol |
| Exact Mass | 618.33 |
| IUPAC Name | tert-butyl-[(3E,5E)-8-[tert-butyl(diphenyl)silyl]oxyocta-3,5-dienoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCC/C=C/C=C/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H50O2Si2/c1-39(2,3)43(35-25-15-11-16-26-35,36-27-17-12-18-28-36)41-33-23-9-7-8-10-24-34-42-44(40(4,5)6,37-29-19-13-20-30-37)38-31-21-14-22-32-38/h7-22,25-32H,23-24,33-34H2,1-6H3/b9-7+,10-8+ |
| InChIKey | NLXKQWKZIKXROI-FIFLTTCUSA-N |
| XLogP | 8.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.01 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|