C12H11Cl3N2OS — CID 56968381
2-(3-chloropropylsulfanyl)-5-[(2,4-dichlorophenyl)methyl]-1,3,4-oxadiazole (PubChem CID 56968381) has the molecular formula C12H11Cl3N2OS and a molecular weight of 337.66 g/mol. Its IUPAC name is 2-(3-chloropropylsulfanyl)-5-[(2,4-dichlorophenyl)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-(3-chloropropylsulfanyl)-5-[(2,4-dichlorophenyl)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 56968381 |
| Molecular Formula | C12H11Cl3N2OS |
| Molecular Weight | 337.66 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 2-(3-chloropropylsulfanyl)-5-[(2,4-dichlorophenyl)methyl]-1,3,4-oxadiazole |
| SMILES | ClCCCSc1nnc(Cc2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C12H11Cl3N2OS/c13-4-1-5-19-12-17-16-11(18-12)6-8-2-3-9(14)7-10(8)15/h2-3,7H,1,4-6H2 |
| InChIKey | FWMJRDGJIKMIHZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.66 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|