C11H7Cl3N2O2S — CID 56968383
S-[5-[(2,4-dichlorophenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-chloroethanethioate (PubChem CID 56968383) has the molecular formula C11H7Cl3N2O2S and a molecular weight of 337.62 g/mol. Its IUPAC name is S-[5-[(2,4-dichlorophenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-chloroethanethioate.
| Compound Name | S-[5-[(2,4-dichlorophenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-chloroethanethioate |
|---|---|
| PubChem CID | 56968383 |
| Molecular Formula | C11H7Cl3N2O2S |
| Molecular Weight | 337.62 g/mol |
| Exact Mass | 335.93 |
| IUPAC Name | S-[5-[(2,4-dichlorophenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-chloroethanethioate |
| SMILES | O=C(CCl)Sc1nnc(Cc2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C11H7Cl3N2O2S/c12-5-10(17)19-11-16-15-9(18-11)3-6-1-2-7(13)4-8(6)14/h1-2,4H,3,5H2 |
| InChIKey | ZNACIFQQPFWHTL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|