C12H22O4 — CID 56968566
ethyl (E,4S,7R)-7,9-dihydroxy-4-methylnon-2-enoate (PubChem CID 56968566) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is ethyl (E,4S,7R)-7,9-dihydroxy-4-methylnon-2-enoate.
| Compound Name | ethyl (E,4S,7R)-7,9-dihydroxy-4-methylnon-2-enoate |
|---|---|
| PubChem CID | 56968566 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | ethyl (E,4S,7R)-7,9-dihydroxy-4-methylnon-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](C)CC[C@@H](O)CCO |
| InChI | InChI=1S/C12H22O4/c1-3-16-12(15)7-5-10(2)4-6-11(14)8-9-13/h5,7,10-11,13-14H,3-4,6,8-9H2,1-2H3/b7-5+/t10-,11+/m0/s1 |
| InChIKey | KGDDYDGGKSOMNK-KKSDUGGKSA-N |
| XLogP | 1.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|