C37H31N7O — CID 56968752
1-[4-[3-[4-(1-aminocyclobutyl)phenyl]-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-4-yl]phenyl]-3-phenylurea (PubChem CID 56968752) has the molecular formula C37H31N7O and a molecular weight of 589.70 g/mol. Its IUPAC name is 1-[4-[3-[4-(1-aminocyclobutyl)phenyl]-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-4-yl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[3-[4-(1-aminocyclobutyl)phenyl]-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-4-yl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 56968752 |
| Molecular Formula | C37H31N7O |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | 1-[4-[3-[4-(1-aminocyclobutyl)phenyl]-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-4-yl]phenyl]-3-phenylurea |
| SMILES | NC1(c2ccc(-c3c(-c4ccc(NC(=O)Nc5ccccc5)cc4)nc4n3-c3cccnc3Nc3ccccc3-4)cc2)CCC1 |
| InChI | InChI=1S/C37H31N7O/c38-37(21-7-22-37)26-17-13-25(14-18-26)33-32(24-15-19-28(20-16-24)41-36(45)40-27-8-2-1-3-9-27)43-35-29-10-4-5-11-30(29)42-34-31(44(33)35)12-6-23-39-34/h1-6,8-20,23H,7,21-22,38H2,(H,39,42)(H2,40,41,45) |
| InChIKey | ZXTXMISROREPAI-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 109.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |