C29H32N2O6S — CID 56969250
(9E)-5-(3,4,5-trimethoxyphenyl)-9-[(3,4,5-trimethoxyphenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline (PubChem CID 56969250) has the molecular formula C29H32N2O6S and a molecular weight of 536.65 g/mol. Its IUPAC name is (9E)-5-(3,4,5-trimethoxyphenyl)-9-[(3,4,5-trimethoxyphenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline.
| Compound Name | (9E)-5-(3,4,5-trimethoxyphenyl)-9-[(3,4,5-trimethoxyphenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline |
|---|---|
| PubChem CID | 56969250 |
| Molecular Formula | C29H32N2O6S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | (9E)-5-(3,4,5-trimethoxyphenyl)-9-[(3,4,5-trimethoxyphenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline |
| SMILES | COc1cc(/C=C2\CCCC3=C2N=C2SC=CN2C3c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C29H32N2O6S/c1-32-21-13-17(14-22(33-2)27(21)36-5)12-18-8-7-9-20-25(18)30-29-31(10-11-38-29)26(20)19-15-23(34-3)28(37-6)24(16-19)35-4/h10-16,26H,7-9H2,1-6H3/b18-12+ |
| InChIKey | OEWKLPSMXCAEPQ-LDADJPATSA-N |
| XLogP | 6.19 |
| TPSA | 70.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |