C10H17BO6 — CID 56969454
[(Z)-2-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethenyl]boronic acid (PubChem CID 56969454) has the molecular formula C10H17BO6 and a molecular weight of 244.05 g/mol. Its IUPAC name is [(Z)-2-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethenyl]boronic acid.
| Compound Name | [(Z)-2-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethenyl]boronic acid |
|---|---|
| PubChem CID | 56969454 |
| Molecular Formula | C10H17BO6 |
| Molecular Weight | 244.05 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | [(Z)-2-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethenyl]boronic acid |
| SMILES | CO[C@@H]1O[C@H](/C=C\B(O)O)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C10H17BO6/c1-10(2)16-7-6(4-5-11(12)13)15-9(14-3)8(7)17-10/h4-9,12-13H,1-3H3/b5-4-/t6-,7-,8-,9-/m1/s1 |
| InChIKey | HISPYFKZAYAYFO-WBWOQNSDSA-N |
| XLogP | -0.55 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.05 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|