C12H19NO3 — CID 56969455
(1S,2R,3R,6R)-6-[bis(prop-2-enyl)amino]cyclohex-4-ene-1,2,3-triol (PubChem CID 56969455) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (1S,2R,3R,6R)-6-[bis(prop-2-enyl)amino]cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1S,2R,3R,6R)-6-[bis(prop-2-enyl)amino]cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 56969455 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (1S,2R,3R,6R)-6-[bis(prop-2-enyl)amino]cyclohex-4-ene-1,2,3-triol |
| SMILES | C=CCN(CC=C)[C@@H]1C=C[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H19NO3/c1-3-7-13(8-4-2)9-5-6-10(14)12(16)11(9)15/h3-6,9-12,14-16H,1-2,7-8H2/t9-,10-,11+,12-/m1/s1 |
| InChIKey | NDCJEFQCFFUAPQ-WISYIIOYSA-N |
| XLogP | -0.32 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|