C19H34O4 — CID 56969533
ethyl (E,4R)-4-[(4S,5S,6R)-6-[(2S)-butan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-2-methylpent-2-enoate (PubChem CID 56969533) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is ethyl (E,4R)-4-[(4S,5S,6R)-6-[(2S)-butan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-2-methylpent-2-enoate.
| Compound Name | ethyl (E,4R)-4-[(4S,5S,6R)-6-[(2S)-butan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-2-methylpent-2-enoate |
|---|---|
| PubChem CID | 56969533 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | ethyl (E,4R)-4-[(4S,5S,6R)-6-[(2S)-butan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-2-methylpent-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H](C)[C@@H]1OC(C)(C)O[C@H]([C@@H](C)CC)[C@@H]1C |
| InChI | InChI=1S/C19H34O4/c1-9-12(3)16-15(6)17(23-19(7,8)22-16)13(4)11-14(5)18(20)21-10-2/h11-13,15-17H,9-10H2,1-8H3/b14-11+/t12-,13+,15-,16+,17-/m0/s1 |
| InChIKey | TZGFUOHNJDJENR-USZFNGFWSA-N |
| XLogP | 4.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|